C32H48F5NO4S — CID 87850956
9-[(7R,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-N-(4,4,5,5,5-pentafluoropentyl)nonane-1-sulfonamide (PubChem CID 87850956) has the molecular formula C32H48F5NO4S and a molecular weight of 637.80 g/mol. Its IUPAC name is 9-[(7R,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-N-(4,4,5,5,5-pentafluoropentyl)nonane-1-sulfonamide.
| Compound Name | 9-[(7R,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-N-(4,4,5,5,5-pentafluoropentyl)nonane-1-sulfonamide |
|---|---|
| PubChem CID | 87850956 |
| Molecular Formula | C32H48F5NO4S |
| Molecular Weight | 637.80 g/mol |
| Exact Mass | 637.32 |
| IUPAC Name | 9-[(7R,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-N-(4,4,5,5,5-pentafluoropentyl)nonane-1-sulfonamide |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4C[C@@H](CCCCCCCCCS(=O)(=O)NCCCC(F)(F)C(F)(F)F)[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C32H48F5NO4S/c1-30-17-15-26-25-12-11-24(39)21-23(25)20-22(29(26)27(30)13-14-28(30)40)10-7-5-3-2-4-6-8-19-43(41,42)38-18-9-16-31(33,34)32(35,36)37/h11-12,21-22,26-29,38-40H,2-10,13-20H2,1H3/t22-,26-,27+,28+,29-,30+/m1/s1 |
| InChIKey | BFQGTMMVCUSLQO-LSVBPWPTSA-N |
| XLogP | 7.85 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.80 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|