C32H48F5NO3S — CID 176964388
(7R,8R,9S,13S,14S,17S)-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfonimidoyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 176964388) has the molecular formula C32H48F5NO3S and a molecular weight of 621.80 g/mol. Its IUPAC name is (7R,8R,9S,13S,14S,17S)-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfonimidoyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (7R,8R,9S,13S,14S,17S)-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfonimidoyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 176964388 |
| Molecular Formula | C32H48F5NO3S |
| Molecular Weight | 621.80 g/mol |
| Exact Mass | 621.33 |
| IUPAC Name | (7R,8R,9S,13S,14S,17S)-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfonimidoyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | [H]N=S(=O)(CCCCCCCCC[C@@H]1Cc2cc(O)ccc2[C@H]2CC[C@]3(C)[C@@H](O)CC[C@H]3[C@H]12)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C32H48F5NO3S/c1-30-17-15-26-25-12-11-24(39)21-23(25)20-22(29(26)27(30)13-14-28(30)40)10-7-5-3-2-4-6-8-18-42(38,41)19-9-16-31(33,34)32(35,36)37/h11-12,21-22,26-29,38-40H,2-10,13-20H2,1H3/t22-,26-,27+,28+,29-,30+,42?/m1/s1 |
| InChIKey | ONAGARAYIWSFTP-NHMOCZOPSA-N |
| XLogP | 8.98 |
| TPSA | 81.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.80 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|