C32H49F3O3S — CID 118443903
(7R)-13-methyl-7-[9-(5,5,5-trifluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 118443903) has the molecular formula C32H49F3O3S and a molecular weight of 570.80 g/mol. Its IUPAC name is (7R)-13-methyl-7-[9-(5,5,5-trifluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (7R)-13-methyl-7-[9-(5,5,5-trifluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 118443903 |
| Molecular Formula | C32H49F3O3S |
| Molecular Weight | 570.80 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | (7R)-13-methyl-7-[9-(5,5,5-trifluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CC12CCC3c4ccc(O)cc4CC(CCCCCCCCCS(=O)CCCCC(F)(F)F)C3C1CCC2O |
| InChI | InChI=1S/C32H49F3O3S/c1-31-18-16-27-26-13-12-25(36)22-24(26)21-23(30(27)28(31)14-15-29(31)37)11-7-5-3-2-4-6-9-19-39(38)20-10-8-17-32(33,34)35/h12-13,22-23,27-30,36-37H,2-11,14-21H2,1H3 |
| InChIKey | OIQOHUBRVMLWOH-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.80 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|