C32H43F5O3S — CID 143089086
(7R)-3-hydroxy-13-methyl-17-methylidene-7-[8-(4,4,5,5,5-pentafluoropentylsulfinyl)octyl]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-one (PubChem CID 143089086) has the molecular formula C32H43F5O3S and a molecular weight of 602.75 g/mol. Its IUPAC name is (7R)-3-hydroxy-13-methyl-17-methylidene-7-[8-(4,4,5,5,5-pentafluoropentylsulfinyl)octyl]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-one.
| Compound Name | (7R)-3-hydroxy-13-methyl-17-methylidene-7-[8-(4,4,5,5,5-pentafluoropentylsulfinyl)octyl]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 143089086 |
| Molecular Formula | C32H43F5O3S |
| Molecular Weight | 602.75 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | (7R)-3-hydroxy-13-methyl-17-methylidene-7-[8-(4,4,5,5,5-pentafluoropentylsulfinyl)octyl]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-one |
| SMILES | C=C1C(=O)CC2C3C(CCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)Cc4cc(O)ccc4C3CCC12C |
| InChI | InChI=1S/C32H43F5O3S/c1-21-28(39)20-27-29-22(18-23-19-24(38)11-12-25(23)26(29)13-15-30(21,27)2)10-7-5-3-4-6-8-16-41(40)17-9-14-31(33,34)32(35,36)37/h11-12,19,22,26-27,29,38H,1,3-10,13-18,20H2,2H3 |
| InChIKey | YAJUWSOTVDTXLO-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.75 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|