C35H49F9O3S — CID 162603075
(7R,13S,16R)-13,17,17-trimethyl-7-[9-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfinyl)nonyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,16-diol (PubChem CID 162603075) has the molecular formula C35H49F9O3S and a molecular weight of 720.82 g/mol. Its IUPAC name is (7R,13S,16R)-13,17,17-trimethyl-7-[9-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfinyl)nonyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,16-diol.
| Compound Name | (7R,13S,16R)-13,17,17-trimethyl-7-[9-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfinyl)nonyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,16-diol |
|---|---|
| PubChem CID | 162603075 |
| Molecular Formula | C35H49F9O3S |
| Molecular Weight | 720.82 g/mol |
| Exact Mass | 720.33 |
| IUPAC Name | (7R,13S,16R)-13,17,17-trimethyl-7-[9-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfinyl)nonyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,16-diol |
| SMILES | CC1(C)[C@H](O)CC2C3C(CCCCCCCCCS(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)Cc4cc(O)ccc4C3CC[C@@]21C |
| InChI | InChI=1S/C35H49F9O3S/c1-30(2)28(46)21-27-29-22(19-23-20-24(45)12-13-25(23)26(29)14-15-31(27,30)3)11-9-7-5-4-6-8-10-17-48(47)18-16-32(36,37)33(38,39)34(40,41)35(42,43)44/h12-13,20,22,26-29,45-46H,4-11,14-19,21H2,1-3H3/t22?,26?,27?,28-,29?,31+,48?/m1/s1 |
| InChIKey | GKPRAAVFNNNITM-QCBSQDEOSA-N |
| XLogP | 10.20 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.82 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|