C35H47F9O3S — CID 58899387
(7R,13S,16R)-13-methyl-17-methylidene-7-[9-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfinyl)nonyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,16-diol (PubChem CID 58899387) has the molecular formula C35H47F9O3S and a molecular weight of 718.81 g/mol. Its IUPAC name is (7R,13S,16R)-13-methyl-17-methylidene-7-[9-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfinyl)nonyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,16-diol.
| Compound Name | (7R,13S,16R)-13-methyl-17-methylidene-7-[9-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfinyl)nonyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,16-diol |
|---|---|
| PubChem CID | 58899387 |
| Molecular Formula | C35H47F9O3S |
| Molecular Weight | 718.81 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | (7R,13S,16R)-13-methyl-17-methylidene-7-[9-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfinyl)nonyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,16-diol |
| SMILES | C=C1[C@H](O)CC2C3C(CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)Cc4cc(O)ccc4C3CC[C@]12C |
| InChI | InChI=1S/C35H47F9O3S/c1-22-29(46)21-28-30-23(19-24-20-25(45)12-13-26(24)27(30)14-16-31(22,28)2)11-8-6-4-3-5-7-9-17-48(47)18-10-15-32(36,37)33(38,39)34(40,41)35(42,43)44/h12-13,20,23,27-30,45-46H,1,3-11,14-19,21H2,2H3/t23?,27?,28?,29-,30?,31-,48?/m1/s1 |
| InChIKey | RCODGEVHQQCIIB-AOYQXICZSA-N |
| XLogP | 10.12 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.81 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|