C33H47F5O4S — CID 11445059
(6R,7S,13S,16R)-13-methyl-17-methylidene-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,6,16-triol (PubChem CID 11445059) has the molecular formula C33H47F5O4S and a molecular weight of 634.79 g/mol. Its IUPAC name is (6R,7S,13S,16R)-13-methyl-17-methylidene-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,6,16-triol.
| Compound Name | (6R,7S,13S,16R)-13-methyl-17-methylidene-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,6,16-triol |
|---|---|
| PubChem CID | 11445059 |
| Molecular Formula | C33H47F5O4S |
| Molecular Weight | 634.79 g/mol |
| Exact Mass | 634.31 |
| IUPAC Name | (6R,7S,13S,16R)-13-methyl-17-methylidene-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,6,16-triol |
| SMILES | C=C1[C@H](O)CC2C3C(CC[C@]12C)c1ccc(O)cc1[C@H](O)C3CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C33H47F5O4S/c1-21-28(40)20-27-29-24(14-16-31(21,27)2)23-13-12-22(39)19-26(23)30(41)25(29)11-8-6-4-3-5-7-9-17-43(42)18-10-15-32(34,35)33(36,37)38/h12-13,19,24-25,27-30,39-41H,1,3-11,14-18,20H2,2H3/t24?,25?,27?,28-,29?,30-,31-,43?/m1/s1 |
| InChIKey | TTXANFLSNVDIOV-FDCDYHROSA-N |
| XLogP | 8.34 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.79 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|