C36H47F9O4 — CID 162603015
11-[(6S,13S)-3,6-dihydroxy-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-7-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)undecanoic acid (PubChem CID 162603015) has the molecular formula C36H47F9O4 and a molecular weight of 714.75 g/mol. Its IUPAC name is 11-[(6S,13S)-3,6-dihydroxy-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-7-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)undecanoic acid.
| Compound Name | 11-[(6S,13S)-3,6-dihydroxy-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-7-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)undecanoic acid |
|---|---|
| PubChem CID | 162603015 |
| Molecular Formula | C36H47F9O4 |
| Molecular Weight | 714.75 g/mol |
| Exact Mass | 714.33 |
| IUPAC Name | 11-[(6S,13S)-3,6-dihydroxy-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-7-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)undecanoic acid |
| SMILES | C=C1CCC2C3C(CC[C@]12C)c1ccc(O)cc1[C@@H](O)C3CCCCCCCCCC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C36H47F9O4/c1-21-12-15-28-29-25(17-18-32(21,28)2)24-14-13-23(46)20-27(24)30(47)26(29)11-9-7-5-3-4-6-8-10-22(31(48)49)16-19-33(37,38)34(39,40)35(41,42)36(43,44)45/h13-14,20,22,25-26,28-30,46-47H,1,3-12,15-19H2,2H3,(H,48,49)/t22?,25?,26?,28?,29?,30-,32+/m0/s1 |
| InChIKey | YHLKTWNNVLRMIO-WLZHOGCDSA-N |
| XLogP | 10.98 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.75 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|