C35H47F9O4 — CID 90756055
(2R)-11-[(13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)undecanoic acid (PubChem CID 90756055) has the molecular formula C35H47F9O4 and a molecular weight of 702.74 g/mol. Its IUPAC name is (2R)-11-[(13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)undecanoic acid.
| Compound Name | (2R)-11-[(13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)undecanoic acid |
|---|---|
| PubChem CID | 90756055 |
| Molecular Formula | C35H47F9O4 |
| Molecular Weight | 702.74 g/mol |
| Exact Mass | 702.33 |
| IUPAC Name | (2R)-11-[(13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)undecanoic acid |
| SMILES | C[C@]12CC(CCCCCCCCC[C@H](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O)C3c4ccc(O)cc4CCC3C1CCC2O |
| InChI | InChI=1S/C35H47F9O4/c1-31-20-23(29-25-14-12-24(45)19-22(25)11-13-26(29)27(31)15-16-28(31)46)10-8-6-4-2-3-5-7-9-21(30(47)48)17-18-32(36,37)33(38,39)34(40,41)35(42,43)44/h12,14,19,21,23,26-29,45-46H,2-11,13,15-18,20H2,1H3,(H,47,48)/t21-,23?,26?,27?,28?,29?,31+/m1/s1 |
| InChIKey | KQPFFXQOUBVOIU-JWIQTTHUSA-N |
| XLogP | 10.30 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.74 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|