C30H49NO2 — CID 69339107
(8S,9S,11S,13S,14S,17S)-13-methyl-11-[5-[methyl(4-methylpentyl)amino]pentyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 69339107) has the molecular formula C30H49NO2 and a molecular weight of 455.73 g/mol. Its IUPAC name is (8S,9S,11S,13S,14S,17S)-13-methyl-11-[5-[methyl(4-methylpentyl)amino]pentyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,9S,11S,13S,14S,17S)-13-methyl-11-[5-[methyl(4-methylpentyl)amino]pentyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 69339107 |
| Molecular Formula | C30H49NO2 |
| Molecular Weight | 455.73 g/mol |
| Exact Mass | 455.38 |
| IUPAC Name | (8S,9S,11S,13S,14S,17S)-13-methyl-11-[5-[methyl(4-methylpentyl)amino]pentyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CC(C)CCCN(C)CCCCC[C@H]1C[C@]2(C)[C@@H](O)CC[C@H]2[C@@H]2CCc3cc(O)ccc3[C@@H]12 |
| InChI | InChI=1S/C30H49NO2/c1-21(2)9-8-18-31(4)17-7-5-6-10-23-20-30(3)27(15-16-28(30)33)26-13-11-22-19-24(32)12-14-25(22)29(23)26/h12,14,19,21,23,26-29,32-33H,5-11,13,15-18,20H2,1-4H3/t23-,26-,27-,28-,29+,30-/m0/s1 |
| InChIKey | NXONPTAOSGPHSQ-PAOVCLKXSA-N |
| XLogP | 6.76 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.73 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|