C32H51NO4 — CID 139820989
2-[8-[(8S,9S,11S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]octoxy]-N-propan-2-ylpropanamide (PubChem CID 139820989) has the molecular formula C32H51NO4 and a molecular weight of 513.76 g/mol. Its IUPAC name is 2-[8-[(8S,9S,11S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]octoxy]-N-propan-2-ylpropanamide.
| Compound Name | 2-[8-[(8S,9S,11S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]octoxy]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 139820989 |
| Molecular Formula | C32H51NO4 |
| Molecular Weight | 513.76 g/mol |
| Exact Mass | 513.38 |
| IUPAC Name | 2-[8-[(8S,9S,11S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]octoxy]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)C(C)OCCCCCCCC[C@H]1C[C@]2(C)[C@@H](O)CC[C@H]2[C@@H]2CCc3cc(O)ccc3[C@@H]12 |
| InChI | InChI=1S/C32H51NO4/c1-21(2)33-31(36)22(3)37-18-10-8-6-5-7-9-11-24-20-32(4)28(16-17-29(32)35)27-14-12-23-19-25(34)13-15-26(23)30(24)27/h13,15,19,21-22,24,27-30,34-35H,5-12,14,16-18,20H2,1-4H3,(H,33,36)/t22?,24-,27-,28-,29-,30+,32-/m0/s1 |
| InChIKey | FOBRMGUYXNNQHG-HPNNFMIUSA-N |
| XLogP | 6.50 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.76 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|