C36H58O4 — CID 142068300
ethyl 10-[(11S,13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]-2-hexyldecanoate (PubChem CID 142068300) has the molecular formula C36H58O4 and a molecular weight of 554.86 g/mol. Its IUPAC name is ethyl 10-[(11S,13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]-2-hexyldecanoate.
| Compound Name | ethyl 10-[(11S,13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]-2-hexyldecanoate |
|---|---|
| PubChem CID | 142068300 |
| Molecular Formula | C36H58O4 |
| Molecular Weight | 554.86 g/mol |
| Exact Mass | 554.43 |
| IUPAC Name | ethyl 10-[(11S,13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]-2-hexyldecanoate |
| SMILES | CCCCCCC(CCCCCCCC[C@H]1C[C@]2(C)C(O)CCC2C2CCc3cc(O)ccc3C21)C(=O)OCC |
| InChI | InChI=1S/C36H58O4/c1-4-6-7-12-15-26(35(39)40-5-2)16-13-10-8-9-11-14-17-28-25-36(3)32(22-23-33(36)38)31-20-18-27-24-29(37)19-21-30(27)34(28)31/h19,21,24,26,28,31-34,37-38H,4-18,20,22-23,25H2,1-3H3/t26?,28-,31?,32?,33?,34?,36-/m0/s1 |
| InChIKey | XAKICVCXLKHEBC-XXZLYWANSA-N |
| XLogP | 9.11 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.86 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|