C39H59F3O4 — CID 162549266
ethyl (E)-10-[(11S)-3,17-dihydroxy-13-methyl-16-propyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]-2-(6,6,6-trifluorohexyl)dec-7-enoate (PubChem CID 162549266) has the molecular formula C39H59F3O4 and a molecular weight of 648.89 g/mol. Its IUPAC name is ethyl (E)-10-[(11S)-3,17-dihydroxy-13-methyl-16-propyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]-2-(6,6,6-trifluorohexyl)dec-7-enoate.
| Compound Name | ethyl (E)-10-[(11S)-3,17-dihydroxy-13-methyl-16-propyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]-2-(6,6,6-trifluorohexyl)dec-7-enoate |
|---|---|
| PubChem CID | 162549266 |
| Molecular Formula | C39H59F3O4 |
| Molecular Weight | 648.89 g/mol |
| Exact Mass | 648.44 |
| IUPAC Name | ethyl (E)-10-[(11S)-3,17-dihydroxy-13-methyl-16-propyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]-2-(6,6,6-trifluorohexyl)dec-7-enoate |
| SMILES | CCCC1CC2C3CCc4cc(O)ccc4C3[C@@H](CC/C=C/CCCCC(CCCCCC(F)(F)F)C(=O)OCC)CC2(C)C1O |
| InChI | InChI=1S/C39H59F3O4/c1-4-15-29-25-34-33-21-19-28-24-31(43)20-22-32(28)35(33)30(26-38(34,3)36(29)44)18-12-9-7-6-8-11-16-27(37(45)46-5-2)17-13-10-14-23-39(40,41)42/h7,9,20,22,24,27,29-30,33-36,43-44H,4-6,8,10-19,21,23,25-26H2,1-3H3/b9-7+/t27?,29?,30-,33?,34?,35?,36?,38?/m0/s1 |
| InChIKey | YJJUZCSAJLSJDK-FPVOXJGGSA-N |
| XLogP | 10.45 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.89 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|