C20H28O4 — CID 22791896
(8S,9R,11S,13S,14S,16R,17R)-11-(methoxymethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol (PubChem CID 22791896) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (8S,9R,11S,13S,14S,16R,17R)-11-(methoxymethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol.
| Compound Name | (8S,9R,11S,13S,14S,16R,17R)-11-(methoxymethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol |
|---|---|
| PubChem CID | 22791896 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (8S,9R,11S,13S,14S,16R,17R)-11-(methoxymethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol |
| SMILES | COC[C@H]1C[C@]2(C)[C@@H](O)[C@H](O)C[C@H]2[C@@H]2CCc3cc(O)ccc3[C@@H]12 |
| InChI | InChI=1S/C20H28O4/c1-20-9-12(10-24-2)18-14-6-4-13(21)7-11(14)3-5-15(18)16(20)8-17(22)19(20)23/h4,6-7,12,15-19,21-23H,3,5,8-10H2,1-2H3/t12-,15+,16+,17-,18-,19+,20+/m1/s1 |
| InChIKey | RYEYMRHOTCMZPT-BJKQHSPDSA-N |
| XLogP | 2.45 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |