C31H47FO4 — CID 58616056
10-[(11S,13S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]-2-(3-fluoropropyl)decanoic acid (PubChem CID 58616056) has the molecular formula C31H47FO4 and a molecular weight of 502.71 g/mol. Its IUPAC name is 10-[(11S,13S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]-2-(3-fluoropropyl)decanoic acid.
| Compound Name | 10-[(11S,13S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]-2-(3-fluoropropyl)decanoic acid |
|---|---|
| PubChem CID | 58616056 |
| Molecular Formula | C31H47FO4 |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 502.35 |
| IUPAC Name | 10-[(11S,13S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]-2-(3-fluoropropyl)decanoic acid |
| SMILES | C[C@]12C[C@H](CCCCCCCCC(CCCF)C(=O)O)C3c4ccc(O)cc4CCC3C1CC[C@@H]2O |
| InChI | InChI=1S/C31H47FO4/c1-31-20-23(10-7-5-3-2-4-6-9-21(30(35)36)11-8-18-32)29-25-15-13-24(33)19-22(25)12-14-26(29)27(31)16-17-28(31)34/h13,15,19,21,23,26-29,33-34H,2-12,14,16-18,20H2,1H3,(H,35,36)/t21?,23-,26?,27?,28-,29?,31-/m0/s1 |
| InChIKey | OBDZXVOXSSYBQD-CDXJNWRDSA-N |
| XLogP | 7.41 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|