C34H41F9O4S — CID 10283672
11-[3-ethyl-7-hydroxy-3-(4-hydroxyphenyl)-2,4-dihydrothiochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)undecanoic acid (PubChem CID 10283672) has the molecular formula C34H41F9O4S and a molecular weight of 716.75 g/mol. Its IUPAC name is 11-[3-ethyl-7-hydroxy-3-(4-hydroxyphenyl)-2,4-dihydrothiochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)undecanoic acid.
| Compound Name | 11-[3-ethyl-7-hydroxy-3-(4-hydroxyphenyl)-2,4-dihydrothiochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)undecanoic acid |
|---|---|
| PubChem CID | 10283672 |
| Molecular Formula | C34H41F9O4S |
| Molecular Weight | 716.75 g/mol |
| Exact Mass | 716.26 |
| IUPAC Name | 11-[3-ethyl-7-hydroxy-3-(4-hydroxyphenyl)-2,4-dihydrothiochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)undecanoic acid |
| SMILES | CCC1(c2ccc(O)cc2)CSc2cc(O)ccc2C1CCCCCCCCCC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C34H41F9O4S/c1-2-30(23-12-14-24(44)15-13-23)21-48-28-20-25(45)16-17-26(28)27(30)11-9-7-5-3-4-6-8-10-22(29(46)47)18-19-31(35,36)32(37,38)33(39,40)34(41,42)43/h12-17,20,22,27,44-45H,2-11,18-19,21H2,1H3,(H,46,47) |
| InChIKey | HYIVWQMMNGIJLY-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.75 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|