C35H47F9O5 — CID 163973445
10-[(6S,13S)-3,6-dihydroxy-13-methyl-17-methylidene-16-oxo-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-7-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoic acid (PubChem CID 163973445) has the molecular formula C35H47F9O5 and a molecular weight of 718.74 g/mol. Its IUPAC name is 10-[(6S,13S)-3,6-dihydroxy-13-methyl-17-methylidene-16-oxo-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-7-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoic acid.
| Compound Name | 10-[(6S,13S)-3,6-dihydroxy-13-methyl-17-methylidene-16-oxo-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-7-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoic acid |
|---|---|
| PubChem CID | 163973445 |
| Molecular Formula | C35H47F9O5 |
| Molecular Weight | 718.74 g/mol |
| Exact Mass | 718.33 |
| IUPAC Name | 10-[(6S,13S)-3,6-dihydroxy-13-methyl-17-methylidene-16-oxo-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-7-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoic acid |
| SMILES | C=C1C(=O)CC2C3C(CC[C@]12C)C1=CCC(O)CC1[C@@H](O)C3CCCCCCCCC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C35H47F9O5/c1-19-27(46)18-26-28-23(14-15-31(19,26)2)22-12-11-21(45)17-25(22)29(47)24(28)10-8-6-4-3-5-7-9-20(30(48)49)13-16-32(36,37)33(38,39)34(40,41)35(42,43)44/h12,20-21,23-26,28-29,45,47H,1,3-11,13-18H2,2H3,(H,48,49)/t20?,21?,23?,24?,25?,26?,28?,29-,31+/m0/s1 |
| InChIKey | SSALWWVFDUHTGC-RVXRUIBUSA-N |
| XLogP | 8.92 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.74 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|