C35H45F9O4 — CID 143089001
10-[(6S,13S)-3,6-dihydroxy-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-7-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoic acid (PubChem CID 143089001) has the molecular formula C35H45F9O4 and a molecular weight of 700.72 g/mol. Its IUPAC name is 10-[(6S,13S)-3,6-dihydroxy-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-7-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoic acid.
| Compound Name | 10-[(6S,13S)-3,6-dihydroxy-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-7-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoic acid |
|---|---|
| PubChem CID | 143089001 |
| Molecular Formula | C35H45F9O4 |
| Molecular Weight | 700.72 g/mol |
| Exact Mass | 700.32 |
| IUPAC Name | 10-[(6S,13S)-3,6-dihydroxy-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-7-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoic acid |
| SMILES | C=C1CCC2C3C(CC[C@]12C)c1ccc(O)cc1[C@@H](O)C3CCCCCCCCC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C35H45F9O4/c1-20-11-14-27-28-24(16-17-31(20,27)2)23-13-12-22(45)19-26(23)29(46)25(28)10-8-6-4-3-5-7-9-21(30(47)48)15-18-32(36,37)33(38,39)34(40,41)35(42,43)44/h12-13,19,21,24-25,27-29,45-46H,1,3-11,14-18H2,2H3,(H,47,48)/t21?,24?,25?,27?,28?,29-,31+/m0/s1 |
| InChIKey | SIKZQIVIFPZTQN-AAVYHZOUSA-N |
| XLogP | 10.59 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.72 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|