C30H45NO3 — CID 56638386
N-butyl-8-[(7R,13S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]oct-5-enamide (PubChem CID 56638386) has the molecular formula C30H45NO3 and a molecular weight of 467.69 g/mol. Its IUPAC name is N-butyl-8-[(7R,13S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]oct-5-enamide.
| Compound Name | N-butyl-8-[(7R,13S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]oct-5-enamide |
|---|---|
| PubChem CID | 56638386 |
| Molecular Formula | C30H45NO3 |
| Molecular Weight | 467.69 g/mol |
| Exact Mass | 467.34 |
| IUPAC Name | N-butyl-8-[(7R,13S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]oct-5-enamide |
| SMILES | CCCCNC(=O)CCCC=CCCC1Cc2cc(O)ccc2C2CC[C@@]3(C)C(CC[C@@H]3O)C12 |
| InChI | InChI=1S/C30H45NO3/c1-3-4-18-31-28(34)11-9-7-5-6-8-10-21-19-22-20-23(32)12-13-24(22)25-16-17-30(2)26(29(21)25)14-15-27(30)33/h5-6,12-13,20-21,25-27,29,32-33H,3-4,7-11,14-19H2,1-2H3,(H,31,34)/t21?,25?,26?,27-,29?,30-/m0/s1 |
| InChIKey | LHQFJDVUCODYQG-QHNCPDBYSA-N |
| XLogP | 6.26 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.69 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|