C26H39NO3 — CID 168849627
[(7R,13S,17S)-7-ethyl-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] N-pentylcarbamate (PubChem CID 168849627) has the molecular formula C26H39NO3 and a molecular weight of 413.60 g/mol. Its IUPAC name is [(7R,13S,17S)-7-ethyl-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] N-pentylcarbamate.
| Compound Name | [(7R,13S,17S)-7-ethyl-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] N-pentylcarbamate |
|---|---|
| PubChem CID | 168849627 |
| Molecular Formula | C26H39NO3 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | [(7R,13S,17S)-7-ethyl-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] N-pentylcarbamate |
| SMILES | CCCCCNC(=O)O[C@H]1CCC2C3C(CC)Cc4cc(O)ccc4C3CC[C@@]21C |
| InChI | InChI=1S/C26H39NO3/c1-4-6-7-14-27-25(29)30-23-11-10-22-24-17(5-2)15-18-16-19(28)8-9-20(18)21(24)12-13-26(22,23)3/h8-9,16-17,21-24,28H,4-7,10-15H2,1-3H3,(H,27,29)/t17?,21?,22?,23-,24?,26-/m0/s1 |
| InChIKey | OGWXBPGLAVUUBZ-QTXBPGGBSA-N |
| XLogP | 6.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|