C25H36O4 — CID 168849670
butyl (7-ethyl-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) carbonate (PubChem CID 168849670) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is butyl (7-ethyl-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) carbonate.
| Compound Name | butyl (7-ethyl-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) carbonate |
|---|---|
| PubChem CID | 168849670 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | butyl (7-ethyl-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) carbonate |
| SMILES | CCCCOC(=O)OC1CCC2C3C(CC)Cc4cc(O)ccc4C3CCC12C |
| InChI | InChI=1S/C25H36O4/c1-4-6-13-28-24(27)29-22-10-9-21-23-16(5-2)14-17-15-18(26)7-8-19(17)20(23)11-12-25(21,22)3/h7-8,15-16,20-23,26H,4-6,9-14H2,1-3H3 |
| InChIKey | YCKGTEDJVNZGQQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|