C33H51FO3S — CID 58599229
[(7R,13S,17S)-7-[9-(4-fluorobutylsulfanyl)nonyl]-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 58599229) has the molecular formula C33H51FO3S and a molecular weight of 546.83 g/mol. Its IUPAC name is [(7R,13S,17S)-7-[9-(4-fluorobutylsulfanyl)nonyl]-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(7R,13S,17S)-7-[9-(4-fluorobutylsulfanyl)nonyl]-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 58599229 |
| Molecular Formula | C33H51FO3S |
| Molecular Weight | 546.83 g/mol |
| Exact Mass | 546.35 |
| IUPAC Name | [(7R,13S,17S)-7-[9-(4-fluorobutylsulfanyl)nonyl]-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC2C3C(CCCCCCCCCSCCCCF)Cc4cc(O)ccc4C3CC[C@@]21C |
| InChI | InChI=1S/C33H51FO3S/c1-24(35)37-31-16-15-30-32-25(12-8-6-4-3-5-7-10-20-38-21-11-9-19-34)22-26-23-27(36)13-14-28(26)29(32)17-18-33(30,31)2/h13-14,23,25,29-32,36H,3-12,15-22H2,1-2H3/t25?,29?,30?,31-,32?,33-/m0/s1 |
| InChIKey | DKJMLDOCZDLMSS-GVKCCALLSA-N |
| XLogP | 9.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.83 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|