C34H54O3S — CID 58019162
[(7R,13S,17S)-3-hydroxy-13-methyl-7-(9-pentylsulfanylnonyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 58019162) has the molecular formula C34H54O3S and a molecular weight of 542.87 g/mol. Its IUPAC name is [(7R,13S,17S)-3-hydroxy-13-methyl-7-(9-pentylsulfanylnonyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(7R,13S,17S)-3-hydroxy-13-methyl-7-(9-pentylsulfanylnonyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 58019162 |
| Molecular Formula | C34H54O3S |
| Molecular Weight | 542.87 g/mol |
| Exact Mass | 542.38 |
| IUPAC Name | [(7R,13S,17S)-3-hydroxy-13-methyl-7-(9-pentylsulfanylnonyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CCCCCSCCCCCCCCCC1Cc2cc(O)ccc2C2CC[C@@]3(C)C(CC[C@@H]3OC(C)=O)C12 |
| InChI | InChI=1S/C34H54O3S/c1-4-5-12-21-38-22-13-10-8-6-7-9-11-14-26-23-27-24-28(36)15-16-29(27)30-19-20-34(3)31(33(26)30)17-18-32(34)37-25(2)35/h15-16,24,26,30-33,36H,4-14,17-23H2,1-3H3/t26?,30?,31?,32-,33?,34-/m0/s1 |
| InChIKey | MVDFJTARBSSLBM-OMOJBNJDSA-N |
| XLogP | 9.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.87 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|