C40H57NO3 — CID 86741440
N-[9-[(7S,8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]non-8-enyl]hexanamide (PubChem CID 86741440) has the molecular formula C40H57NO3 and a molecular weight of 599.90 g/mol. Its IUPAC name is N-[9-[(7S,8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]non-8-enyl]hexanamide.
| Compound Name | N-[9-[(7S,8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]non-8-enyl]hexanamide |
|---|---|
| PubChem CID | 86741440 |
| Molecular Formula | C40H57NO3 |
| Molecular Weight | 599.90 g/mol |
| Exact Mass | 599.43 |
| IUPAC Name | N-[9-[(7S,8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]non-8-enyl]hexanamide |
| SMILES | CCCCCC(=O)NCCCCCCCC=C[C@@H]1Cc2cc(OCc3ccccc3)ccc2[C@H]2CC[C@]3(C)[C@@H](O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C40H57NO3/c1-3-4-11-19-38(43)41-26-15-9-7-5-6-8-14-18-31-27-32-28-33(44-29-30-16-12-10-13-17-30)20-21-34(32)35-24-25-40(2)36(39(31)35)22-23-37(40)42/h10,12-14,16-18,20-21,28,31,35-37,39,42H,3-9,11,15,19,22-27,29H2,1-2H3,(H,41,43)/t31-,35-,36+,37+,39-,40+/m1/s1 |
| InChIKey | PMNWBQNKEOKGNH-VGVXOFRRSA-N |
| XLogP | 9.30 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.90 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|