C27H32O4 — CID 71271704
(8S,9S,13R,14S,16S)-7-methoxy-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16-carboxylic acid (PubChem CID 71271704) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is (8S,9S,13R,14S,16S)-7-methoxy-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16-carboxylic acid.
| Compound Name | (8S,9S,13R,14S,16S)-7-methoxy-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16-carboxylic acid |
|---|---|
| PubChem CID | 71271704 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | (8S,9S,13R,14S,16S)-7-methoxy-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16-carboxylic acid |
| SMILES | COC1Cc2cc(OCc3ccccc3)ccc2[C@H]2CC[C@]3(C)C[C@@H](C(=O)O)C[C@H]3[C@H]12 |
| InChI | InChI=1S/C27H32O4/c1-27-11-10-22-21-9-8-20(31-16-17-6-4-3-5-7-17)12-18(21)14-24(30-2)25(22)23(27)13-19(15-27)26(28)29/h3-9,12,19,22-25H,10-11,13-16H2,1-2H3,(H,28,29)/t19-,22+,23-,24?,25+,27+/m0/s1 |
| InChIKey | LTUXQYGEPMLBLK-AJIJQBQGSA-N |
| XLogP | 5.45 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |