C21H30O — CID 141064216
(7R,8S,9S,13R,14R,16S)-3-methoxy-7,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 141064216) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is (7R,8S,9S,13R,14R,16S)-3-methoxy-7,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (7R,8S,9S,13R,14R,16S)-3-methoxy-7,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 141064216 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (7R,8S,9S,13R,14R,16S)-3-methoxy-7,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | COc1ccc2c(c1)C[C@@H](C)[C@@H]1[C@@H]2CC[C@]2(C)C[C@@H](C)C[C@H]12 |
| InChI | InChI=1S/C21H30O/c1-13-9-19-20-14(2)10-15-11-16(22-4)5-6-17(15)18(20)7-8-21(19,3)12-13/h5-6,11,13-14,18-20H,7-10,12H2,1-4H3/t13-,14+,18+,19+,20+,21+/m0/s1 |
| InChIKey | OFUDAIYZOUYYJD-GZWWGJMXSA-N |
| XLogP | 5.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |