C22H28O4 — CID 91602524
(8'S,9'S,13'S,14'S)-3'-methoxy-7',13'-dimethylspiro[1,3-dioxolane-2,17'-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene]-11'-one (PubChem CID 91602524) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is (8'S,9'S,13'S,14'S)-3'-methoxy-7',13'-dimethylspiro[1,3-dioxolane-2,17'-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene]-11'-one.
| Compound Name | (8'S,9'S,13'S,14'S)-3'-methoxy-7',13'-dimethylspiro[1,3-dioxolane-2,17'-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene]-11'-one |
|---|---|
| PubChem CID | 91602524 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (8'S,9'S,13'S,14'S)-3'-methoxy-7',13'-dimethylspiro[1,3-dioxolane-2,17'-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene]-11'-one |
| SMILES | COc1ccc2c(c1)CC(C)[C@@H]1[C@@H]2C(=O)C[C@@]2(C)[C@H]1CCC21OCCO1 |
| InChI | InChI=1S/C22H28O4/c1-13-10-14-11-15(24-3)4-5-16(14)20-18(23)12-21(2)17(19(13)20)6-7-22(21)25-8-9-26-22/h4-5,11,13,17,19-20H,6-10,12H2,1-3H3/t13?,17-,19-,20-,21-/m0/s1 |
| InChIKey | PBBJAUXYHHAPNP-GAPHHYNESA-N |
| XLogP | 3.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |