C21H28O4 — CID 18756062
7',13'-dimethylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3',11'-diol (PubChem CID 18756062) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is 7',13'-dimethylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3',11'-diol.
| Compound Name | 7',13'-dimethylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3',11'-diol |
|---|---|
| PubChem CID | 18756062 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 7',13'-dimethylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3',11'-diol |
| SMILES | CC1Cc2cc(O)ccc2C2C(O)CC3(C)C(CCC34OCCO4)C12 |
| InChI | InChI=1S/C21H28O4/c1-12-9-13-10-14(22)3-4-15(13)19-17(23)11-20(2)16(18(12)19)5-6-21(20)24-7-8-25-21/h3-4,10,12,16-19,22-23H,5-9,11H2,1-2H3 |
| InChIKey | HPLXSLIDTYRTDM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |