C21H27BrO2 — CID 88636404
(7R,8R,9S,13S,14S,17R)-17-[(Z)-2-bromoethenyl]-7,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 88636404) has the molecular formula C21H27BrO2 and a molecular weight of 391.35 g/mol. Its IUPAC name is (7R,8R,9S,13S,14S,17R)-17-[(Z)-2-bromoethenyl]-7,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (7R,8R,9S,13S,14S,17R)-17-[(Z)-2-bromoethenyl]-7,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 88636404 |
| Molecular Formula | C21H27BrO2 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (7R,8R,9S,13S,14S,17R)-17-[(Z)-2-bromoethenyl]-7,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@@H]1Cc2cc(O)ccc2[C@H]2CC[C@@]3(C)[C@@H](CC[C@@]3(O)/C=C\Br)[C@H]12 |
| InChI | InChI=1S/C21H27BrO2/c1-13-11-14-12-15(23)3-4-16(14)17-5-7-20(2)18(19(13)17)6-8-21(20,24)9-10-22/h3-4,9-10,12-13,17-19,23-24H,5-8,11H2,1-2H3/b10-9-/t13-,17-,18+,19-,20+,21-/m1/s1 |
| InChIKey | PDDFXNHFWJTCKV-ZWNHERPMSA-N |
| XLogP | 5.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |