C25H29O2 — CID 11814231
CID 11814231 (PubChem CID 11814231) has the molecular formula C25H29O2 and a molecular weight of 361.50 g/mol.
| Compound Name | CID 11814231 |
|---|---|
| PubChem CID | 11814231 |
| Molecular Formula | C25H29O2 |
| Molecular Weight | 361.50 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | — |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@]2(O)/C=C/[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C25H29O2/c1-24-13-11-21-20-9-7-19(26)16-18(20)6-8-22(21)23(24)12-15-25(24,27)14-10-17-4-2-3-5-17/h2-5,7,9-10,14,16,21-23,26-27H,6,8,11-13,15H2,1H3/b14-10+/t21-,22-,23+,24+,25+/m1/s1 |
| InChIKey | XFCZRRDQVGLJTE-SICPUWSWSA-N |
| XLogP | 4.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |