C24H28O2S — CID 56950657
(13S,17R)-13-methyl-17-[(E)-2-thiophen-3-ylethenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 56950657) has the molecular formula C24H28O2S and a molecular weight of 380.55 g/mol. Its IUPAC name is (13S,17R)-13-methyl-17-[(E)-2-thiophen-3-ylethenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (13S,17R)-13-methyl-17-[(E)-2-thiophen-3-ylethenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 56950657 |
| Molecular Formula | C24H28O2S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (13S,17R)-13-methyl-17-[(E)-2-thiophen-3-ylethenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CCC3c4ccc(O)cc4CCC3C1CC[C@@]2(O)/C=C/c1ccsc1 |
| InChI | InChI=1S/C24H28O2S/c1-23-10-7-20-19-5-3-18(25)14-17(19)2-4-21(20)22(23)8-12-24(23,26)11-6-16-9-13-27-15-16/h3,5-6,9,11,13-15,20-22,25-26H,2,4,7-8,10,12H2,1H3/b11-6+/t20?,21?,22?,23-,24-/m0/s1 |
| InChIKey | PQRKYRUCFYMUTR-UYLOHTQZSA-N |
| XLogP | 5.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |