C27H42N2O — CID 54751279
(17E)-17-[2-[2-(diethylamino)ethylamino]ethylidene]-7,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol (PubChem CID 54751279) has the molecular formula C27H42N2O and a molecular weight of 410.65 g/mol. Its IUPAC name is (17E)-17-[2-[2-(diethylamino)ethylamino]ethylidene]-7,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (17E)-17-[2-[2-(diethylamino)ethylamino]ethylidene]-7,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 54751279 |
| Molecular Formula | C27H42N2O |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.33 |
| IUPAC Name | (17E)-17-[2-[2-(diethylamino)ethylamino]ethylidene]-7,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCN(CC)CCNC/C=C1\CCC2C3C(C)Cc4cc(O)ccc4C3CCC12C |
| InChI | InChI=1S/C27H42N2O/c1-5-29(6-2)16-15-28-14-12-21-7-10-25-26-19(3)17-20-18-22(30)8-9-23(20)24(26)11-13-27(21,25)4/h8-9,12,18-19,24-26,28,30H,5-7,10-11,13-17H2,1-4H3/b21-12+ |
| InChIKey | WZGHYSXZHMLTBR-CIAFOILYSA-N |
| XLogP | 5.35 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|