C27H41NO3 — CID 91268692
(7R,8S,9S,13S,14S)-17-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethylidene]-7,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol (PubChem CID 91268692) has the molecular formula C27H41NO3 and a molecular weight of 427.63 g/mol. Its IUPAC name is (7R,8S,9S,13S,14S)-17-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethylidene]-7,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (7R,8S,9S,13S,14S)-17-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethylidene]-7,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 91268692 |
| Molecular Formula | C27H41NO3 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | (7R,8S,9S,13S,14S)-17-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethylidene]-7,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@@H]1Cc2cc(O)ccc2[C@H]2CC[C@]3(C)C(=CCOCCOCCN(C)C)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C27H41NO3/c1-19-17-20-18-22(29)6-7-23(20)24-9-11-27(2)21(5-8-25(27)26(19)24)10-13-30-15-16-31-14-12-28(3)4/h6-7,10,18-19,24-26,29H,5,8-9,11-17H2,1-4H3/t19-,24-,25+,26-,27-/m1/s1 |
| InChIKey | CQZHPHAGABCUTB-KGGTYKQNSA-N |
| XLogP | 5.02 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|