C25H37NO2 — CID 10293362
(7R,17E)-17-[2-[2-(dimethylamino)ethoxy]ethylidene]-7,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol (PubChem CID 10293362) has the molecular formula C25H37NO2 and a molecular weight of 383.58 g/mol. Its IUPAC name is (7R,17E)-17-[2-[2-(dimethylamino)ethoxy]ethylidene]-7,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (7R,17E)-17-[2-[2-(dimethylamino)ethoxy]ethylidene]-7,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 10293362 |
| Molecular Formula | C25H37NO2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | (7R,17E)-17-[2-[2-(dimethylamino)ethoxy]ethylidene]-7,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC1Cc2cc(O)ccc2C2CCC3(C)/C(=C/COCCN(C)C)CCC3C12 |
| InChI | InChI=1S/C25H37NO2/c1-17-15-18-16-20(27)6-7-21(18)22-9-11-25(2)19(5-8-23(25)24(17)22)10-13-28-14-12-26(3)4/h6-7,10,16-17,22-24,27H,5,8-9,11-15H2,1-4H3/b19-10+ |
| InChIKey | GQZWNJNOJJKVOH-VXLYETTFSA-N |
| XLogP | 5.00 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|