C23H33O3P — CID 59965908
2-[(2E)-2-[(7R)-7,13-dimethyl-3-phosphanyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]ethoxy]ethanol (PubChem CID 59965908) has the molecular formula C23H33O3P and a molecular weight of 388.49 g/mol. Its IUPAC name is 2-[(2E)-2-[(7R)-7,13-dimethyl-3-phosphanyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]ethoxy]ethanol.
| Compound Name | 2-[(2E)-2-[(7R)-7,13-dimethyl-3-phosphanyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]ethoxy]ethanol |
|---|---|
| PubChem CID | 59965908 |
| Molecular Formula | C23H33O3P |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2-[(2E)-2-[(7R)-7,13-dimethyl-3-phosphanyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]ethoxy]ethanol |
| SMILES | CC1Cc2cc(OP)ccc2C2CCC3(C)/C(=C/COCCO)CCC3C12 |
| InChI | InChI=1S/C23H33O3P/c1-15-13-16-14-18(26-27)4-5-19(16)20-7-9-23(2)17(8-11-25-12-10-24)3-6-21(23)22(15)20/h4-5,8,14-15,20-22,24H,3,6-7,9-13,27H2,1-2H3/b17-8+ |
| InChIKey | GCMNNVKKRUELBO-CAOOACKPSA-N |
| XLogP | 4.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|