C29H33FO3 — CID 70677238
(7R,8R,9S,13S,14S,17S)-17-[2-(4-fluorophenyl)ethynyl]-13-methyl-7-propoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 70677238) has the molecular formula C29H33FO3 and a molecular weight of 448.58 g/mol. Its IUPAC name is (7R,8R,9S,13S,14S,17S)-17-[2-(4-fluorophenyl)ethynyl]-13-methyl-7-propoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (7R,8R,9S,13S,14S,17S)-17-[2-(4-fluorophenyl)ethynyl]-13-methyl-7-propoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 70677238 |
| Molecular Formula | C29H33FO3 |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | (7R,8R,9S,13S,14S,17S)-17-[2-(4-fluorophenyl)ethynyl]-13-methyl-7-propoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CCCO[C@@H]1Cc2cc(O)ccc2[C@H]2CC[C@@]3(C)[C@@H](CC[C@@]3(O)C#Cc3ccc(F)cc3)[C@@H]21 |
| InChI | InChI=1S/C29H33FO3/c1-3-16-33-26-18-20-17-22(31)8-9-23(20)24-11-13-28(2)25(27(24)26)12-15-29(28,32)14-10-19-4-6-21(30)7-5-19/h4-9,17,24-27,31-32H,3,11-13,15-16,18H2,1-2H3/t24-,25+,26-,27-,28+,29+/m1/s1 |
| InChIKey | RCUIXZLFDHEEHU-HOQNYSLDSA-N |
| XLogP | 5.58 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|