C27H38O2Si — CID 53319810
(8R,9S,13S,14S,17S)-17-[2-[diethyl(prop-2-enyl)silyl]ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 53319810) has the molecular formula C27H38O2Si and a molecular weight of 422.69 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-17-[2-[diethyl(prop-2-enyl)silyl]ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17S)-17-[2-[diethyl(prop-2-enyl)silyl]ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 53319810 |
| Molecular Formula | C27H38O2Si |
| Molecular Weight | 422.69 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | (8R,9S,13S,14S,17S)-17-[2-[diethyl(prop-2-enyl)silyl]ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C=CC[Si](C#C[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(O)ccc4[C@H]3CC[C@@]21C)(CC)CC |
| InChI | InChI=1S/C27H38O2Si/c1-5-17-30(6-2,7-3)18-16-27(29)15-13-25-24-10-8-20-19-21(28)9-11-22(20)23(24)12-14-26(25,27)4/h5,9,11,19,23-25,28-29H,1,6-8,10,12-15,17H2,2-4H3/t23-,24-,25+,26+,27-/m1/s1 |
| InChIKey | XPKSDKJGNIXKCH-IONQDRQYSA-N |
| XLogP | 6.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.69 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|