C28H42O2Si — CID 53321207
(8R,9S,13S,14S,17S)-17-[2-[butan-2-yl(diethyl)silyl]ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 53321207) has the molecular formula C28H42O2Si and a molecular weight of 438.73 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-17-[2-[butan-2-yl(diethyl)silyl]ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17S)-17-[2-[butan-2-yl(diethyl)silyl]ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 53321207 |
| Molecular Formula | C28H42O2Si |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (8R,9S,13S,14S,17S)-17-[2-[butan-2-yl(diethyl)silyl]ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CCC(C)[Si](C#C[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(O)ccc4[C@H]3CC[C@@]21C)(CC)CC |
| InChI | InChI=1S/C28H42O2Si/c1-6-20(4)31(7-2,8-3)18-17-28(30)16-14-26-25-11-9-21-19-22(29)10-12-23(21)24(25)13-15-27(26,28)5/h10,12,19-20,24-26,29-30H,6-9,11,13-16H2,1-5H3/t20?,24-,25-,26+,27+,28-/m1/s1 |
| InChIKey | TXYMLNDWOMQMNA-PYSUCSTNSA-N |
| XLogP | 6.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|