C23H31BrO2Si — CID 53319811
(8R,9S,13S,14S,17S)-17-[2-[bromomethyl(dimethyl)silyl]ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 53319811) has the molecular formula C23H31BrO2Si and a molecular weight of 447.49 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-17-[2-[bromomethyl(dimethyl)silyl]ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17S)-17-[2-[bromomethyl(dimethyl)silyl]ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 53319811 |
| Molecular Formula | C23H31BrO2Si |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | (8R,9S,13S,14S,17S)-17-[2-[bromomethyl(dimethyl)silyl]ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@]2(O)C#C[Si](C)(C)CBr |
| InChI | InChI=1S/C23H31BrO2Si/c1-22-10-8-19-18-7-5-17(25)14-16(18)4-6-20(19)21(22)9-11-23(22,26)12-13-27(2,3)15-24/h5,7,14,19-21,25-26H,4,6,8-11,15H2,1-3H3/t19-,20-,21+,22+,23-/m1/s1 |
| InChIKey | WASDDOBMLOQVSW-MHMIHQHRSA-N |
| XLogP | 5.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|