C25H33NO2Si — CID 53323868
3-[2-[(8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethynyl-dimethylsilyl]propanenitrile (PubChem CID 53323868) has the molecular formula C25H33NO2Si and a molecular weight of 407.63 g/mol. Its IUPAC name is 3-[2-[(8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethynyl-dimethylsilyl]propanenitrile.
| Compound Name | 3-[2-[(8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethynyl-dimethylsilyl]propanenitrile |
|---|---|
| PubChem CID | 53323868 |
| Molecular Formula | C25H33NO2Si |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 3-[2-[(8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethynyl-dimethylsilyl]propanenitrile |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@]2(O)C#C[Si](C)(C)CCC#N |
| InChI | InChI=1S/C25H33NO2Si/c1-24-11-9-21-20-8-6-19(27)17-18(20)5-7-22(21)23(24)10-12-25(24,28)13-16-29(2,3)15-4-14-26/h6,8,17,21-23,27-28H,4-5,7,9-12,15H2,1-3H3/t21-,22-,23+,24+,25-/m1/s1 |
| InChIKey | PLIOMNQPWDHIAV-WJGLBBAVSA-N |
| XLogP | 5.14 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|