C26H25BrF2O2 — CID 139202464
(8R,9S,13S,14S,17S)-17-[2-(4-bromo-2,5-difluorophenyl)ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 139202464) has the molecular formula C26H25BrF2O2 and a molecular weight of 487.38 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-17-[2-(4-bromo-2,5-difluorophenyl)ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17S)-17-[2-(4-bromo-2,5-difluorophenyl)ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 139202464 |
| Molecular Formula | C26H25BrF2O2 |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | (8R,9S,13S,14S,17S)-17-[2-(4-bromo-2,5-difluorophenyl)ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@]2(O)C#Cc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C26H25BrF2O2/c1-25-9-7-19-18-5-3-17(30)12-15(18)2-4-20(19)21(25)8-11-26(25,31)10-6-16-13-24(29)22(27)14-23(16)28/h3,5,12-14,19-21,30-31H,2,4,7-9,11H2,1H3/t19-,20-,21+,25+,26+/m1/s1 |
| InChIKey | ZDFBILNTCHIHOB-FNSHUVQQSA-N |
| XLogP | 6.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|