C41H51NO6 — CID 139145145
bis((8R,9S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol);nitromethane (PubChem CID 139145145) has the molecular formula C41H51NO6 and a molecular weight of 653.86 g/mol. Its IUPAC name is bis((8R,9S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol);nitromethane.
| Compound Name | bis((8R,9S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol);nitromethane |
|---|---|
| PubChem CID | 139145145 |
| Molecular Formula | C41H51NO6 |
| Molecular Weight | 653.86 g/mol |
| Exact Mass | 653.37 |
| IUPAC Name | bis((8R,9S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol);nitromethane |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(O)ccc4[C@H]3CC[C@@]21C.C#C[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(O)ccc4[C@H]3CC[C@@]21C.C[N+](=O)[O-] |
| InChI | InChI=1S/2C20H24O2.CH3NO2/c2*1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2;1-2(3)4/h2*1,5,7,12,16-18,21-22H,4,6,8-11H2,2H3;1H3/t2*16-,17-,18+,19+,20+;/m11./s1 |
| InChIKey | QHMLMIKTPJQOSI-ONAFJOGASA-N |
| XLogP | 7.12 |
| TPSA | 124.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.86 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|