C24H33NO5S — CID 170337833
(8R,9S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol;pyrrolidine-1-sulfonic acid (PubChem CID 170337833) has the molecular formula C24H33NO5S and a molecular weight of 447.60 g/mol. Its IUPAC name is (8R,9S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol;pyrrolidine-1-sulfonic acid.
| Compound Name | (8R,9S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol;pyrrolidine-1-sulfonic acid |
|---|---|
| PubChem CID | 170337833 |
| Molecular Formula | C24H33NO5S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | (8R,9S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol;pyrrolidine-1-sulfonic acid |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(O)ccc4[C@H]3CC[C@@]21C.O=S(=O)(O)N1CCCC1 |
| InChI | InChI=1S/C20H24O2.C4H9NO3S/c1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2;6-9(7,8)5-3-1-2-4-5/h1,5,7,12,16-18,21-22H,4,6,8-11H2,2H3;1-4H2,(H,6,7,8)/t16-,17-,18+,19+,20+;/m1./s1 |
| InChIKey | VSCPKDLXEZJZGK-KBRHESHBSA-N |
| XLogP | 3.50 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|