C26H30N2O2 — CID 11003954
(8R,9S,13S,14S,17S)-17-[2-(4-hydrazinylphenyl)ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 11003954) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-17-[2-(4-hydrazinylphenyl)ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17S)-17-[2-(4-hydrazinylphenyl)ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 11003954 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | (8R,9S,13S,14S,17S)-17-[2-(4-hydrazinylphenyl)ethynyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@]2(O)C#Cc1ccc(NN)cc1 |
| InChI | InChI=1S/C26H30N2O2/c1-25-13-11-22-21-9-7-20(29)16-18(21)4-8-23(22)24(25)12-15-26(25,30)14-10-17-2-5-19(28-27)6-3-17/h2-3,5-7,9,16,22-24,28-30H,4,8,11-13,15,27H2,1H3/t22-,23-,24+,25+,26+/m1/s1 |
| InChIKey | GKQXGWRDOVWKFH-JMTTVTNBSA-N |
| XLogP | 4.32 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|