C22H30O4 — CID 175549593
(8S)-13-methyl-17-(2-methyl-1,3-dioxolan-2-yl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,11-diol (PubChem CID 175549593) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (8S)-13-methyl-17-(2-methyl-1,3-dioxolan-2-yl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,11-diol.
| Compound Name | (8S)-13-methyl-17-(2-methyl-1,3-dioxolan-2-yl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,11-diol |
|---|---|
| PubChem CID | 175549593 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (8S)-13-methyl-17-(2-methyl-1,3-dioxolan-2-yl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,11-diol |
| SMILES | CC1(C2CCC3[C@@H]4CCc5cc(O)ccc5C4C(O)CC32C)OCCO1 |
| InChI | InChI=1S/C22H30O4/c1-21-12-18(24)20-15-6-4-14(23)11-13(15)3-5-16(20)17(21)7-8-19(21)22(2)25-9-10-26-22/h4,6,11,16-20,23-24H,3,5,7-10,12H2,1-2H3/t16-,17?,18?,19?,20?,21?/m0/s1 |
| InChIKey | AAZLBGYBXRKTFA-YADZBRFQSA-N |
| XLogP | 3.60 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |