C20H26O4 — CID 5195886
(11,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) acetate (PubChem CID 5195886) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (11,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) acetate.
| Compound Name | (11,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) acetate |
|---|---|
| PubChem CID | 5195886 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (11,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)CCC1C2C(O)CC2(C)C(O)CCC12 |
| InChI | InChI=1S/C20H26O4/c1-11(21)24-13-4-6-14-12(9-13)3-5-15-16-7-8-18(23)20(16,2)10-17(22)19(14)15/h4,6,9,15-19,22-23H,3,5,7-8,10H2,1-2H3 |
| InChIKey | VXWXOZXZODPTHP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|