C24H35NO2 — CID 22796460
(8S,9S,11S,13S,14S,17S)-11,13-dimethyl-3-piperidin-2-yloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 22796460) has the molecular formula C24H35NO2 and a molecular weight of 369.55 g/mol. Its IUPAC name is (8S,9S,11S,13S,14S,17S)-11,13-dimethyl-3-piperidin-2-yloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8S,9S,11S,13S,14S,17S)-11,13-dimethyl-3-piperidin-2-yloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 22796460 |
| Molecular Formula | C24H35NO2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | (8S,9S,11S,13S,14S,17S)-11,13-dimethyl-3-piperidin-2-yloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@H]1C[C@]2(C)[C@@H](O)CC[C@H]2[C@@H]2CCc3cc(OC4CCCCN4)ccc3[C@H]21 |
| InChI | InChI=1S/C24H35NO2/c1-15-14-24(2)20(10-11-21(24)26)19-8-6-16-13-17(7-9-18(16)23(15)19)27-22-5-3-4-12-25-22/h7,9,13,15,19-23,25-26H,3-6,8,10-12,14H2,1-2H3/t15-,19-,20-,21-,22?,23+,24-/m0/s1 |
| InChIKey | VXDXOIDPTGYEKX-VKWLHDNESA-N |
| XLogP | 4.63 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |