C23H35NO2 — CID 22796467
(8S,9S,11S,13S,14S,17S)-11,13-dimethyl-3-pyrrolidin-2-yloxy-1,4,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 22796467) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is (8S,9S,11S,13S,14S,17S)-11,13-dimethyl-3-pyrrolidin-2-yloxy-1,4,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8S,9S,11S,13S,14S,17S)-11,13-dimethyl-3-pyrrolidin-2-yloxy-1,4,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 22796467 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | (8S,9S,11S,13S,14S,17S)-11,13-dimethyl-3-pyrrolidin-2-yloxy-1,4,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@H]1C[C@]2(C)[C@@H](O)CC[C@H]2[C@@H]2CCC3=C(CC=C(OC4CCCN4)C3)[C@H]21 |
| InChI | InChI=1S/C23H35NO2/c1-14-13-23(2)19(9-10-20(23)25)18-7-5-15-12-16(6-8-17(15)22(14)18)26-21-4-3-11-24-21/h6,14,18-22,24-25H,3-5,7-13H2,1-2H3/t14-,18-,19-,20-,21?,22+,23-/m0/s1 |
| InChIKey | BFFCNZINGCVKRO-IQJMOZOHSA-N |
| XLogP | 4.53 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|