C36H43NO3 — CID 22883479
4-[4-[(11'S,13'S,17'S)-17'-hydroxy-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]phenyl]benzonitrile (PubChem CID 22883479) has the molecular formula C36H43NO3 and a molecular weight of 537.74 g/mol. Its IUPAC name is 4-[4-[(11'S,13'S,17'S)-17'-hydroxy-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]phenyl]benzonitrile.
| Compound Name | 4-[4-[(11'S,13'S,17'S)-17'-hydroxy-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 22883479 |
| Molecular Formula | C36H43NO3 |
| Molecular Weight | 537.74 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | 4-[4-[(11'S,13'S,17'S)-17'-hydroxy-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]phenyl]benzonitrile |
| SMILES | CC1(C)COC2(CCC3=C(CCC4C3[C@@H](c3ccc(-c5ccc(C#N)cc5)cc3)C[C@@]3(C)C4CC[C@@H]3O)C2)OC1 |
| InChI | InChI=1S/C36H43NO3/c1-34(2)21-39-36(40-22-34)17-16-28-27(18-36)12-13-29-31-14-15-32(38)35(31,3)19-30(33(28)29)26-10-8-25(9-11-26)24-6-4-23(20-37)5-7-24/h4-11,29-33,38H,12-19,21-22H2,1-3H3/t29?,30-,31?,32+,33?,35+/m1/s1 |
| InChIKey | UBIQMWXILSZBFN-NOIJVUPGSA-N |
| XLogP | 7.77 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.74 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|