C33H42O4 — CID 22883473
(8'S,9'R,11'S,13'S,14'S,17'S)-11'-[4-(furan-3-yl)phenyl]-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-17'-ol (PubChem CID 22883473) has the molecular formula C33H42O4 and a molecular weight of 502.70 g/mol. Its IUPAC name is (8'S,9'R,11'S,13'S,14'S,17'S)-11'-[4-(furan-3-yl)phenyl]-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-17'-ol.
| Compound Name | (8'S,9'R,11'S,13'S,14'S,17'S)-11'-[4-(furan-3-yl)phenyl]-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-17'-ol |
|---|---|
| PubChem CID | 22883473 |
| Molecular Formula | C33H42O4 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | (8'S,9'R,11'S,13'S,14'S,17'S)-11'-[4-(furan-3-yl)phenyl]-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-17'-ol |
| SMILES | CC1(C)COC2(CCC3=C(CC[C@@H]4[C@@H]3[C@@H](c3ccc(-c5ccoc5)cc3)C[C@]3(C)[C@@H](O)CC[C@@H]43)C2)OC1 |
| InChI | InChI=1S/C33H42O4/c1-31(2)19-36-33(37-20-31)14-12-25-23(16-33)8-9-26-28-10-11-29(34)32(28,3)17-27(30(25)26)22-6-4-21(5-7-22)24-13-15-35-18-24/h4-7,13,15,18,26-30,34H,8-12,14,16-17,19-20H2,1-3H3/t26-,27+,28-,29-,30+,32-/m0/s1 |
| InChIKey | SLIDMTXAUKXUCH-LHFWKWSXSA-N |
| XLogP | 7.49 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|